CAS Registry Number 2786-00-7
Name:
Benzoic acid, 5-?iodo-?2-?methoxy-
o-Anisic acid, 5-iodo- (7CI,8CI)
5-Iodo-2-methoxybenzoic acid

Chemical Formula: C8H7IO3
Exact Mass: 277.94
Molecular Weight: 278.04
m/z: 277.94 (100.0%), 278.95 (8.8%)

InChI:InChI=1S/C8H7IO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,1H3,(H,10,11)

Specification

98%

1. (1) Paul, Tapas; Organic Letters 2006, V8(18), P4007-4010 CAPLUS
2. (2) El-Kabbani, Ossama; European Journal of Medicinal Chemistry 2010, V45(11), P5309-5317 CAPLUS
3. (4) Xu, Yu Ping; Applied Radiation and Isotopes 2009, V67(4), P594-597 CAPLUS
4. (5) Yusubov, Mekhman S.; Synthetic Communications 2007, V37(8), P1259-1265 CAPLUS
5. (6) Lee, Seung Hwan; Synthetic Communications 2009, V39(22), P4069-4078 CAPLUS